Products 1638764-22-3
CAS 1638764-22-3 appears in our catalog under these names: 4-Chloro-2,6-dimethyl-7h-pyrrolo[2,3-d]pyrimidine, 95%, 4-chloro-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 500mg.
4-chloro-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine (CAS 1638764-22-3) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 4-chloro-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: CQRHTSFHCJFYEX-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 4-chloro-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | CQRHTSFHCJFYEX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)N=C(N=C2Cl)C |
Computed by PubChem (NCBI)