Products 1638764-70-1

CAS 1638764-70-1 is the registry number for 5-methoxy-1H-indazole-7-carboxylic acid, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

5-methoxy-1H-indazole-7-carboxylic acid (CAS 1638764-70-1) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 5-methoxy-1H-indazole-7-carboxylic acid. InChIKey: FMNVIQWDSVVMTK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8N2O3
Molecular weight192.17 g/mol
IUPAC name5-methoxy-1H-indazole-7-carboxylic acid
InChIKeyFMNVIQWDSVVMTK-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C(=C1)C(=O)O)NN=C2

Computed by PubChem (NCBI)