CAS 1638767-73-3 is the registry number for Methyl 1-methylpyrrolo(2,3-b)pyridine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 500mg.
Methyl 1-methylpyrrolo[2,3-b]pyridine-3-carboxylate (CAS 1638767-73-3) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: methyl 1-methylpyrrolo[2,3-b]pyridine-3-carboxylate. InChIKey: IVHLOIKNKUXUNU-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | methyl 1-methylpyrrolo[2,3-b]pyridine-3-carboxylate |
| InChIKey | IVHLOIKNKUXUNU-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1N=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)