CAS 16390-07-1 appears in our catalog under these names: Indomethacin Impurity 5, Indomethacin Impurity 21, 4-Chloro-N-(4-methoxyphenyl)benzohydrazide 95+%, 4-Chloro-N-(4-methoxyphenyl)benzohydrazide, 95+%, 95+%. Offered by: Chemat Brand, Hubei YoungXin, Ambeed, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g.
4-chloro-N-(4-methoxyphenyl)benzohydrazide (CAS 16390-07-1) is a chemical compound with the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. IUPAC name: 4-chloro-N-(4-methoxyphenyl)benzohydrazide. InChIKey: IURNVVIQOMTXSM-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O2 |
|---|---|
| Molecular weight | 276.72 g/mol |
| IUPAC name | 4-chloro-N-(4-methoxyphenyl)benzohydrazide |
| InChIKey | IURNVVIQOMTXSM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N(C(=O)C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)