CAS 1639063-72-1 is the registry number for 1,1-Bis(4-(4,4-dimethyl-4,5-dihydrooxazol-2-yl)phenyl)ethanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1-bis[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]ethanol (CAS 1639063-72-1) is a chemical compound with the molecular formula C24H28N2O3 and a molecular weight of 392.5 g/mol. IUPAC name: 1,1-bis[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]ethanol. InChIKey: PLEOPKVTMOCTRE-UHFFFAOYSA-N.
| Molecular formula | C24H28N2O3 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | 1,1-bis[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]ethanol |
| InChIKey | PLEOPKVTMOCTRE-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=CC=C(C=C2)C(C)(C3=CC=C(C=C3)C4=NC(CO4)(C)C)O)C |
Computed by PubChem (NCBI)