CAS 443093-86-5 appears in our catalog under these names: Valsartan Impurity 31, Valsartan Impurity 50, Valsartan Impurity 8, N-((2'-Cyano(1,1'-biphenyl)-4-yl)methyl)-N-(1-oxopentyl)-L-valine. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]-3-methylbutanoic acid (CAS 443093-86-5) is a chemical compound with the molecular formula C24H28N2O3 and a molecular weight of 392.5 g/mol. IUPAC name: (2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]-3-methylbutanoic acid. InChIKey: RPEKUWAESSKCLD-QHCPKHFHSA-N.
| Molecular formula | C24H28N2O3 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | (2S)-2-[[4-(2-cyanophenyl)phenyl]methyl-pentanoylamino]-3-methylbutanoic acid |
| InChIKey | RPEKUWAESSKCLD-QHCPKHFHSA-N |
| SMILES | CCCCC(=O)N(CC1=CC=C(C=C1)C2=CC=CC=C2C#N)[C@@H](C(C)C)C(=O)O |
Computed by PubChem (NCBI)