Products 2760759-58-6
CAS 2760759-58-6 is the registry number for 5-Amino-2,4-di-tert-butylphenyl 4-oxo-1,4-dihydroquinoline-3-carboxylate. Offered by: TRC. Available pack sizes: 250mg.
(5-amino-2,4-ditert-butylphenyl) 4-oxo-1H-quinoline-3-carboxylate (CAS 2760759-58-6) is a chemical compound with the molecular formula C24H28N2O3 and a molecular weight of 392.5 g/mol. IUPAC name: (5-amino-2,4-ditert-butylphenyl) 4-oxo-1H-quinoline-3-carboxylate. InChIKey: GMRMRJONHIXAPM-UHFFFAOYSA-N.
| Molecular formula | C24H28N2O3 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | (5-amino-2,4-ditert-butylphenyl) 4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | GMRMRJONHIXAPM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1N)OC(=O)C2=CNC3=CC=CC=C3C2=O)C(C)(C)C |
Computed by PubChem (NCBI)