Products 873051-52-6
CAS 873051-52-6 appears in our catalog under these names: Ivacaftor Impurity 5, Ivacaftor Orthoisomer. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
N-(3,5-ditert-butyl-2-hydroxyphenyl)-4-oxo-1H-quinoline-3-carboxamide (CAS 873051-52-6) is a chemical compound with the molecular formula C24H28N2O3 and a molecular weight of 392.5 g/mol. IUPAC name: N-(3,5-ditert-butyl-2-hydroxyphenyl)-4-oxo-1H-quinoline-3-carboxamide. InChIKey: IYUOJODHESOPMY-UHFFFAOYSA-N.
| Molecular formula | C24H28N2O3 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | N-(3,5-ditert-butyl-2-hydroxyphenyl)-4-oxo-1H-quinoline-3-carboxamide |
| InChIKey | IYUOJODHESOPMY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)NC(=O)C2=CNC3=CC=CC=C3C2=O)O)C(C)(C)C |
Computed by PubChem (NCBI)