CAS 1639810-41-5 appears in our catalog under these names: Kresoxim-methyl Impurity 2, 2-Desmethyl-2-hydroxymethyl Kresoxim-methyl Carboxylic Acid, >95% (HPLC), (E)-Kresoxim-2-hydroxymethyl (free acid), (E)-Kresoxim-2-hydroxymethyl (free acid), Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Hubei YoungXin, TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 1x1ml.
(2E)-2-[2-[[2-(hydroxymethyl)phenoxy]methyl]phenyl]-2-methoxyiminoacetic acid (CAS 1639810-41-5) is a chemical compound with the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. IUPAC name: (2E)-2-[2-[[2-(hydroxymethyl)phenoxy]methyl]phenyl]-2-methoxyiminoacetic acid. InChIKey: VYCKDLWRTQBZRB-FBMGVBCBSA-N.
| Molecular formula | C17H17NO5 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | (2E)-2-[2-[[2-(hydroxymethyl)phenoxy]methyl]phenyl]-2-methoxyiminoacetic acid |
| InChIKey | VYCKDLWRTQBZRB-FBMGVBCBSA-N |
| SMILES | CO/N=C(\C1=CC=CC=C1COC2=CC=CC=C2CO)/C(=O)O |
Computed by PubChem (NCBI)