Products 1639892-78-6
CAS 1639892-78-6 is the registry number for methyl 2-hydroxy-2-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
Methyl 2-hydroxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (CAS 1639892-78-6) is a chemical compound with the molecular formula C15H21BO5 and a molecular weight of 292.14 g/mol. IUPAC name: methyl 2-hydroxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate. InChIKey: HMNUFMMQTOZXBE-UHFFFAOYSA-N.
| Molecular formula | C15H21BO5 |
|---|---|
| Molecular weight | 292.14 g/mol |
| IUPAC name | methyl 2-hydroxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| InChIKey | HMNUFMMQTOZXBE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(C(=O)OC)O |
Computed by PubChem (NCBI)