Products 1639933-79-1
CAS 1639933-79-1 is the registry number for LolCDE-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[2-tert-butyl-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2H-imidazol-4-yl]pyridine (CAS 1639933-79-1) is a chemical compound with the molecular formula C20H21N3O2 and a molecular weight of 335.4 g/mol. IUPAC name: 4-[2-tert-butyl-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2H-imidazol-4-yl]pyridine. InChIKey: PHMKDXHUEUNUOM-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O2 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 4-[2-tert-butyl-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2H-imidazol-4-yl]pyridine |
| InChIKey | PHMKDXHUEUNUOM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1N=C(C(=N1)C2=CC3=C(C=C2)OCCO3)C4=CC=NC=C4 |
Computed by PubChem (NCBI)