CAS 16400-51-4 appears in our catalog under these names: 3,3'-Dibromo-1,1'-biphenyl, 98%, 3,3'–Dibromo–1,1'–biphenyl. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 25g, 100g, 5g, 10g.
1-bromo-3-(3-bromophenyl)benzene (CAS 16400-51-4) is a chemical compound with the molecular formula C12H8Br2 and a molecular weight of 312.00 g/mol. IUPAC name: 1-bromo-3-(3-bromophenyl)benzene. InChIKey: LPLLWKZDMKTEMV-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2 |
|---|---|
| Molecular weight | 312.00 g/mol |
| IUPAC name | 1-bromo-3-(3-bromophenyl)benzene |
| InChIKey | LPLLWKZDMKTEMV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)