CAS 53592-10-2 is the registry number for 2,4-Dibromo-1,1'-biphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2,4-dibromo-1-phenylbenzene (CAS 53592-10-2) is a chemical compound with the molecular formula C12H8Br2 and a molecular weight of 312.00 g/mol. IUPAC name: 2,4-dibromo-1-phenylbenzene. InChIKey: BWVLLEHUUJBZMR-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2 |
|---|---|
| Molecular weight | 312.00 g/mol |
| IUPAC name | 2,4-dibromo-1-phenylbenzene |
| InChIKey | BWVLLEHUUJBZMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)Br)Br |
Computed by PubChem (NCBI)