CAS 57186-90-0 appears in our catalog under these names: 1-Bromo-3-(4-bromophenyl)benzene, 95%, 3,4'–dibromobiphenyl, 1-bromo-3-(4-bromophenyl)benzene, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g.
1-bromo-3-(4-bromophenyl)benzene (CAS 57186-90-0) is a chemical compound with the molecular formula C12H8Br2 and a molecular weight of 312.00 g/mol. IUPAC name: 1-bromo-3-(4-bromophenyl)benzene. InChIKey: DLAKCVTXQRIHEY-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2 |
|---|---|
| Molecular weight | 312.00 g/mol |
| IUPAC name | 1-bromo-3-(4-bromophenyl)benzene |
| InChIKey | DLAKCVTXQRIHEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)