CAS 77295-63-7 is the registry number for 1-(2,2-Dibromoethenyl)naphthalene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-(2,2-dibromoethenyl)naphthalene (CAS 77295-63-7) is a chemical compound with the molecular formula C12H8Br2 and a molecular weight of 312.00 g/mol. IUPAC name: 1-(2,2-dibromoethenyl)naphthalene. InChIKey: TYXGMECQXLWMSS-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2 |
|---|---|
| Molecular weight | 312.00 g/mol |
| IUPAC name | 1-(2,2-dibromoethenyl)naphthalene |
| InChIKey | TYXGMECQXLWMSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C=C(Br)Br |
Computed by PubChem (NCBI)