Products 92-86-4
CAS 92-86-4 appears in our catalog under these names: 4',4-Dibromobiphenyl, 99.99%, 4,4'-Dibromobiphenyl, 97%, PBB No. 15, PBB No. 15 10 µg/mL in Isooctane, 4,4′–Dibromobiphenyl solution. Offered by: MedChemExpress, Combi-blocks, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 100 g, 250 g, 500 g, 100g, 25g, 5g, 500g, 1kg.
1-bromo-4-(4-bromophenyl)benzene (CAS 92-86-4) is a chemical compound with the molecular formula C12H8Br2 and a molecular weight of 312.00 g/mol. IUPAC name: 1-bromo-4-(4-bromophenyl)benzene. InChIKey: HQJQYILBCQPYBI-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2 |
|---|---|
| Molecular weight | 312.00 g/mol |
| IUPAC name | 1-bromo-4-(4-bromophenyl)benzene |
| InChIKey | HQJQYILBCQPYBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)