Products 1640981-19-6
CAS 1640981-19-6 appears in our catalog under these names: Tegoprazan Impurity 5, 1-Benzyl-4-hydroxy-2-methyl-1H-benzo[d]imidazole-6-carboxylic acid, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 5g, 100mg, 250mg, 1g.
3-benzyl-7-hydroxy-2-methylbenzimidazole-5-carboxylic acid (CAS 1640981-19-6) is a chemical compound with the molecular formula C16H14N2O3 and a molecular weight of 282.29 g/mol. IUPAC name: 3-benzyl-7-hydroxy-2-methylbenzimidazole-5-carboxylic acid. InChIKey: LRVLIEIZJOKBQA-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O3 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 3-benzyl-7-hydroxy-2-methylbenzimidazole-5-carboxylic acid |
| InChIKey | LRVLIEIZJOKBQA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1CC3=CC=CC=C3)C=C(C=C2O)C(=O)O |
Computed by PubChem (NCBI)