CAS 164164-26-5 appears in our catalog under these names: 5–(4–Fluorophenyl)–2–fluorobenzoic Acid, 5-(4-Fluorophenyl)-2-fluorobenzoic acid, 98%, 4,4'-Difluoro-(1,1'-biphenyl)-3-carboxylic acid. Offered by: GLPBio, Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
2-fluoro-5-(4-fluorophenyl)benzoic acid (CAS 164164-26-5) is a chemical compound with the molecular formula C13H8F2O2 and a molecular weight of 234.20 g/mol. IUPAC name: 2-fluoro-5-(4-fluorophenyl)benzoic acid. InChIKey: QFOLNTPEYOGOJM-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O2 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 2-fluoro-5-(4-fluorophenyl)benzoic acid |
| InChIKey | QFOLNTPEYOGOJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)F)C(=O)O)F |
Computed by PubChem (NCBI)