Products 1644301-24-5
CAS 1644301-24-5 is the registry number for (2R)-2-(1-Oxo-2,3-dihydro-1H-isoindol-2-yl)-3-phenylpropanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(2R)-2-(3-oxo-1H-isoindol-2-yl)-3-phenylpropanoic acid (CAS 1644301-24-5) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: (2R)-2-(3-oxo-1H-isoindol-2-yl)-3-phenylpropanoic acid. InChIKey: FZEBPJBRDFXKIH-OAHLLOKOSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | (2R)-2-(3-oxo-1H-isoindol-2-yl)-3-phenylpropanoic acid |
| InChIKey | FZEBPJBRDFXKIH-OAHLLOKOSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)N1[C@H](CC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)