Products 1644398-88-8

CAS 1644398-88-8 is the registry number for 2-Hydroxy-3-isopropoxy-4-nitrobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-hydroxy-4-nitro-3-propan-2-yloxybenzoic acid (CAS 1644398-88-8) is a chemical compound with the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. IUPAC name: 2-hydroxy-4-nitro-3-propan-2-yloxybenzoic acid. InChIKey: GFSQPYNPKPTBAS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO6
Molecular weight241.20 g/mol
IUPAC name2-hydroxy-4-nitro-3-propan-2-yloxybenzoic acid
InChIKeyGFSQPYNPKPTBAS-UHFFFAOYSA-N
SMILESCC(C)OC1=C(C=CC(=C1O)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)