CAS 1644663-98-8 is the registry number for 6-Bromo-2,5-dichloroquinazoline, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
6-bromo-2,5-dichloroquinazoline (CAS 1644663-98-8) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 6-bromo-2,5-dichloroquinazoline. InChIKey: WPKJKJUGPOBQMU-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 6-bromo-2,5-dichloroquinazoline |
| InChIKey | WPKJKJUGPOBQMU-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=NC=C2C(=C1Br)Cl)Cl |
Computed by PubChem (NCBI)