Products 164513-41-1
CAS 164513-41-1 is the registry number for Methyl 2-bromo-5-(dimethylamino)benzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 250mg.
Methyl 2-bromo-5-(dimethylamino)benzoate (CAS 164513-41-1) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: methyl 2-bromo-5-(dimethylamino)benzoate. InChIKey: DLSMZBNKKTUSHI-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | methyl 2-bromo-5-(dimethylamino)benzoate |
| InChIKey | DLSMZBNKKTUSHI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)