CAS 1645308-94-6 appears in our catalog under these names: N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N,O-dimethyl-L-threonine, 98%, Fmoc-N-Me-L-Thr(Me)-OH 95%, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N,O-dimethyl-L-threonine, 95%, 95%, FMOC-MeThr(Me)-OH, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg, 500mg.
(2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methoxybutanoic acid (CAS 1645308-94-6) is a chemical compound with the molecular formula C21H23NO5 and a molecular weight of 369.4 g/mol. IUPAC name: (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methoxybutanoic acid. InChIKey: QYWLMYHZOUJCGC-YJYMSZOUSA-N.
| Molecular formula | C21H23NO5 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methoxybutanoic acid |
| InChIKey | QYWLMYHZOUJCGC-YJYMSZOUSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC |
Computed by PubChem (NCBI)