Products 1646556-76-4
CAS 1646556-76-4 is the registry number for 1-(3-Bromophenyl)-2-fluoroethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3-bromophenyl)-2-fluoroethanamine;hydrochloride (CAS 1646556-76-4) is a chemical compound with the molecular formula C8H10BrClFN and a molecular weight of 254.53 g/mol. IUPAC name: 1-(3-bromophenyl)-2-fluoroethanamine;hydrochloride. InChIKey: ALQYTWDIMYCHIK-UHFFFAOYSA-N.
| Molecular formula | C8H10BrClFN |
|---|---|
| Molecular weight | 254.53 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2-fluoroethanamine;hydrochloride |
| InChIKey | ALQYTWDIMYCHIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(CF)N.Cl |
Computed by PubChem (NCBI)