Products 1646882-64-5
CAS 1646882-64-5 appears in our catalog under these names: 5-Bromo-1,7-naphthyridine-3-carboxylic acid, 97%, 5-Bromo-1,7-naphthyridine-3-carboxylic acid, 95% （hydrate）. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-bromo-1,7-naphthyridine-3-carboxylic acid (CAS 1646882-64-5) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 5-bromo-1,7-naphthyridine-3-carboxylic acid. InChIKey: UTTFLGYXIKJWNC-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 5-bromo-1,7-naphthyridine-3-carboxylic acid |
| InChIKey | UTTFLGYXIKJWNC-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=CN=CC(=C21)Br)C(=O)O |
Computed by PubChem (NCBI)