CAS 1649964-23-7 is the registry number for 5-Chloro-3-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazole (CAS 1649964-23-7) is a chemical compound with the molecular formula C10H9ClN4 and a molecular weight of 220.66 g/mol. IUPAC name: 5-chloro-3-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazole. InChIKey: BZZNVZNCWQVYIO-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN4 |
|---|---|
| Molecular weight | 220.66 g/mol |
| IUPAC name | 5-chloro-3-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazole |
| InChIKey | BZZNVZNCWQVYIO-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)C2=NNC3=C2C=C(C=C3)Cl |
Computed by PubChem (NCBI)