CAS 1973-03-1 appears in our catalog under these names: 4-Chloro-n-methyl-6-phenyl-1,3,5-triazin-2-amine, 95%, 4-Chloro-N-methyl-6-phenyl-1,3,5-triazin-2-amine, 95+%, 4–Chloro–N–methyl–6–phenyl–1,3,5–triazin–2–amine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-chloro-N-methyl-6-phenyl-1,3,5-triazin-2-amine (CAS 1973-03-1) is a chemical compound with the molecular formula C10H9ClN4 and a molecular weight of 220.66 g/mol. IUPAC name: 4-chloro-N-methyl-6-phenyl-1,3,5-triazin-2-amine. InChIKey: PIFHNYKEBUKOMB-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN4 |
|---|---|
| Molecular weight | 220.66 g/mol |
| IUPAC name | 4-chloro-N-methyl-6-phenyl-1,3,5-triazin-2-amine |
| InChIKey | PIFHNYKEBUKOMB-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=NC(=N1)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)