CAS 2177258-48-7 is the registry number for 4-CHLORO-1-ETHYL-1,6-DIHYDROPYRAZOLO(3,4-D)PYRROLO(2,3-B)PYRIDINE, 95%. Offered by: AmBeed. Available pack sizes: 1g.
7-chloro-3-ethyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene (CAS 2177258-48-7) is a chemical compound with the molecular formula C10H9ClN4 and a molecular weight of 220.66 g/mol. IUPAC name: 7-chloro-3-ethyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene. InChIKey: YTEQYLYDBBRFGV-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN4 |
|---|---|
| Molecular weight | 220.66 g/mol |
| IUPAC name | 7-chloro-3-ethyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene |
| InChIKey | YTEQYLYDBBRFGV-UHFFFAOYSA-N |
| SMILES | CCN1C2=C3C=CN=C3N=C(C2=CN1)Cl |
Computed by PubChem (NCBI)