CAS 17039-14-4 appears in our catalog under these names: 5-(4-Chlorophenyl)pyrimidine-2,4-diamine, 5-(4-Chlorophenyl)pyrimidine-2,4-diamine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 10g.
5-(4-chlorophenyl)pyrimidine-2,4-diamine (CAS 17039-14-4) is a chemical compound with the molecular formula C10H9ClN4 and a molecular weight of 220.66 g/mol. IUPAC name: 5-(4-chlorophenyl)pyrimidine-2,4-diamine. InChIKey: OBYDYFKZLKCNOC-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN4 |
|---|---|
| Molecular weight | 220.66 g/mol |
| IUPAC name | 5-(4-chlorophenyl)pyrimidine-2,4-diamine |
| InChIKey | OBYDYFKZLKCNOC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(N=C2N)N)Cl |
Computed by PubChem (NCBI)