CAS 60478-25-3 is the registry number for 3-(4-Chlorophenyl)-6-hydrazinopyridazine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 5g, 1g.
[6-(4-chlorophenyl)pyridazin-3-yl]hydrazine (CAS 60478-25-3) is a chemical compound with the molecular formula C10H9ClN4 and a molecular weight of 220.66 g/mol. IUPAC name: [6-(4-chlorophenyl)pyridazin-3-yl]hydrazine. InChIKey: AZCTXHPEZWKVGD-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN4 |
|---|---|
| Molecular weight | 220.66 g/mol |
| IUPAC name | [6-(4-chlorophenyl)pyridazin-3-yl]hydrazine |
| InChIKey | AZCTXHPEZWKVGD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(C=C2)NN)Cl |
Computed by PubChem (NCBI)