CAS 165107-97-1 is the registry number for N-(2-Cyano-5-fluorophenyl)acetamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(2-cyano-5-fluorophenyl)acetamide (CAS 165107-97-1) is a chemical compound with the molecular formula C9H7FN2O and a molecular weight of 178.16 g/mol. IUPAC name: N-(2-cyano-5-fluorophenyl)acetamide. InChIKey: RXIMLWYMDFOLEK-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O |
|---|---|
| Molecular weight | 178.16 g/mol |
| IUPAC name | N-(2-cyano-5-fluorophenyl)acetamide |
| InChIKey | RXIMLWYMDFOLEK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)F)C#N |
Computed by PubChem (NCBI)