CAS 16520-78-8 is the registry number for 8-Methoxycirsilineol. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7,8-trimethoxychromen-4-one (CAS 16520-78-8) is a chemical compound with the molecular formula C19H18O8 and a molecular weight of 374.3 g/mol. IUPAC name: 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7,8-trimethoxychromen-4-one. InChIKey: UBZBPKARIHPOEC-UHFFFAOYSA-N.
| Molecular formula | C19H18O8 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7,8-trimethoxychromen-4-one |
| InChIKey | UBZBPKARIHPOEC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C(=C(C(=C3O2)OC)OC)OC)O)O |
Computed by PubChem (NCBI)