CAS 1655-42-1 appears in our catalog under these names: 4-Methyl-2-pentanone-2,4-dinitrophenylhydrazone, 4-Methyl-2-pentanone-2,4-dinitrophenylhydrazone 1000 µg/mL in Acetonitrile, 4-Methyl-2-pentanone-DNPH, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 100mg, 1ml, 1x5ml.
N-(4-methylpentan-2-ylideneamino)-2,4-dinitroaniline (CAS 1655-42-1) is a chemical compound with the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. IUPAC name: N-(4-methylpentan-2-ylideneamino)-2,4-dinitroaniline. InChIKey: UNLVZDNGQXFBAY-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O4 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | N-(4-methylpentan-2-ylideneamino)-2,4-dinitroaniline |
| InChIKey | UNLVZDNGQXFBAY-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=NNC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])C |
Computed by PubChem (NCBI)