Products 2638-94-0
CAS 2638-94-0 appears in our catalog under these names: 4,4'–Azobis(4–cyanovaleric acid), 4,4'-Azobis(4-cyanovaleric acid), 98%, cont. ca 18% water , 4,4'-Azobis(4-cyanovaleric acid), 4,4''-Azobis(4-cyanovaleric acid), >= 98. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Sigma-Aldrich. Available pack sizes: 100g, 250g, 500g, 25g, 0,25kg, 0,5kg, 1kg, 2kg.
4-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid (CAS 2638-94-0) is a chemical compound with the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. IUPAC name: 4-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid. InChIKey: VFXXTYGQYWRHJP-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O4 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 4-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid |
| InChIKey | VFXXTYGQYWRHJP-UHFFFAOYSA-N |
| SMILES | CC(CCC(=O)O)(C#N)N=NC(C)(CCC(=O)O)C#N |
Computed by PubChem (NCBI)
Synonyms:
4,4-Azobis(4-cyanovaleric acid), Pentanoic acid, 4,4'-azobis(4-cyano-, Pentanoic acid, 4,4'-azobis[4-cyano-, 4,4'-Azobis(4-cyanovaleric acid), 4,4'-(Diazene-1,2-diyl)bis(4-cyanopentanoic acid), Azobis(cyanovaleric acid), 4,4'-Azobis(4-cyanopentanoic acid), ACVA, ABCVA, 4,4'-azobis-(4-cyanovaleric acid)