Products 2095417-06-2
CAS 2095417-06-2 is the registry number for 2′-β-C-Methyl-beta-D-6-methylpurine riboside. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,4R,5R)-5-(hydroxymethyl)-3-methyl-2-(6-methylpurin-9-yl)oxolane-3,4-diol (CAS 2095417-06-2) is a chemical compound with the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. IUPAC name: (2R,3R,4R,5R)-5-(hydroxymethyl)-3-methyl-2-(6-methylpurin-9-yl)oxolane-3,4-diol. InChIKey: XHWRGILBOVPBLO-COYOAVQYSA-N.
| Molecular formula | C12H16N4O4 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | (2R,3R,4R,5R)-5-(hydroxymethyl)-3-methyl-2-(6-methylpurin-9-yl)oxolane-3,4-diol |
| InChIKey | XHWRGILBOVPBLO-COYOAVQYSA-N |
| SMILES | CC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@]([C@@H]([C@H](O3)CO)O)(C)O |
Computed by PubChem (NCBI)