Products 57282-69-6
CAS 57282-69-6 appears in our catalog under these names: H–Ala–Ala–pNA, H-Ala-Ala-pNA hydrochloride salt. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 2000mg, 1000mg, 5000mg.
(2S)-2-amino-N-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]propanamide (CAS 57282-69-6) is a chemical compound with the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. IUPAC name: (2S)-2-amino-N-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]propanamide. InChIKey: DGJXYQXDZRCZAS-YUMQZZPRSA-N.
| Molecular formula | C12H16N4O4 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | (2S)-2-amino-N-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]propanamide |
| InChIKey | DGJXYQXDZRCZAS-YUMQZZPRSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)