CAS 16555-98-9 appears in our catalog under these names: 6-Acetyl-7-hydroxy-4-methyl-2h-chromen-2-one, 95%, 6–Acetyl–7–hydroxy–4–methyl–2H–chromen–2–one, 6-Acetyl-7-hydroxy-4-methyl-2H-chromen-2-one, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
6-acetyl-7-hydroxy-4-methylchromen-2-one (CAS 16555-98-9) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 6-acetyl-7-hydroxy-4-methylchromen-2-one. InChIKey: AYAFDQIOLUUJHW-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 6-acetyl-7-hydroxy-4-methylchromen-2-one |
| InChIKey | AYAFDQIOLUUJHW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=CC(=C(C=C12)C(=O)C)O |
Computed by PubChem (NCBI)