CAS 328977-86-2 is the registry number for 2-[(4-Oxo-3,4-dihydroquinazolin-2-yl)thio]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]propanoic acid (CAS 328977-86-2) is a chemical compound with the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. IUPAC name: 2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]propanoic acid. InChIKey: VYCHQMHTSPQPMW-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3S |
|---|---|
| Molecular weight | 250.28 g/mol |
| IUPAC name | 2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]propanoic acid |
| InChIKey | VYCHQMHTSPQPMW-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)SC1=NC2=CC=CC=C2C(=O)N1 |
Computed by PubChem (NCBI)