Products 328977-86-2

CAS 328977-86-2 is the registry number for 2-[(4-Oxo-3,4-dihydroquinazolin-2-yl)thio]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]propanoic acid (CAS 328977-86-2) is a chemical compound with the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. IUPAC name: 2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]propanoic acid. InChIKey: VYCHQMHTSPQPMW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O3S
Molecular weight250.28 g/mol
IUPAC name2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]propanoic acid
InChIKeyVYCHQMHTSPQPMW-UHFFFAOYSA-N
SMILESCC(C(=O)O)SC1=NC2=CC=CC=C2C(=O)N1

Computed by PubChem (NCBI)