Products 1658-27-1
CAS 1658-27-1 appears in our catalog under these names: 1,5-Dioxaspiro[5.5]undecane-2,4-dione, 95+%, 95+%, 1,5-Dioxaspiro[5.5]undecane-2,4-dione, 95+%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
1,5-dioxaspiro[5.5]undecane-2,4-dione (CAS 1658-27-1) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: 1,5-dioxaspiro[5.5]undecane-2,4-dione. InChIKey: IREXLBOGQIUZBO-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 1,5-dioxaspiro[5.5]undecane-2,4-dione |
| InChIKey | IREXLBOGQIUZBO-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)OC(=O)CC(=O)O2 |
Computed by PubChem (NCBI)