CAS 165813-01-4 appears in our catalog under these names: (E/Z)–Droloxifene, (E/Z)-Droloxifene, 98%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 10 mg, 5 mg.
3-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol (CAS 165813-01-4) is a chemical compound with the molecular formula C26H29NO2 and a molecular weight of 387.5 g/mol. IUPAC name: 3-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol. InChIKey: ZQZFYGIXNQKOAV-QPLCGJKRSA-N.
| Molecular formula | C26H29NO2 |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | 3-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
| InChIKey | ZQZFYGIXNQKOAV-QPLCGJKRSA-N |
| SMILES | CC/C(=C(\C1=CC=C(C=C1)OCCN(C)C)/C2=CC(=CC=C2)O)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)