CAS 1659-31-0 appears in our catalog under these names: Carbonic Acid Di–2–pyridyl Ester, Di-2-pyridyl Carbonate, >98.0%(T), DPC 97%, Dipyridin-2-yl carbonate, 97%, 97%, Carbonic acid di-2-pyridyl ester, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 1000g, 10g, 500g, 1kg.
Dipyridin-2-yl carbonate (CAS 1659-31-0) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: dipyridin-2-yl carbonate. InChIKey: GCSAXWHQFYOIFE-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | dipyridin-2-yl carbonate |
| InChIKey | GCSAXWHQFYOIFE-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)OC(=O)OC2=CC=CC=N2 |
Computed by PubChem (NCBI)