CAS 166104-20-7 appears in our catalog under these names: 1-Boc-5-Aminoindole 95%, 1-Boc-5-Aminoindole, 97%, 97%, 1-Boc-5-Aminoindole, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 100mg, 10g.
Tert-butyl 5-aminoindole-1-carboxylate (CAS 166104-20-7) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: tert-butyl 5-aminoindole-1-carboxylate. InChIKey: KYCVRKPFNLCHLL-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | tert-butyl 5-aminoindole-1-carboxylate |
| InChIKey | KYCVRKPFNLCHLL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=CC(=C2)N |
Computed by PubChem (NCBI)