CAS 16632-21-6 appears in our catalog under these names: 5-Nitro-6-methyluracil 97%, 5-Nitro-6-methyluracil, 98%, 2,4-Dihydroxy-6-methyl-5-nitropyrimidine, 5-Nitro-6-methyluracil, 97%, 97%, 6-Methyl-5-nitrouracil, >95.0%(HPLC)(T). Offered by: Ambeed, Fluorochem, TRC, Chemat, TCI. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g, 1kg.
6-methyl-5-nitro-1H-pyrimidine-2,4-dione (CAS 16632-21-6) is a chemical compound with the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. IUPAC name: 6-methyl-5-nitro-1H-pyrimidine-2,4-dione. InChIKey: LIVYMRJSNFHYEN-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O4 |
|---|---|
| Molecular weight | 171.11 g/mol |
| IUPAC name | 6-methyl-5-nitro-1H-pyrimidine-2,4-dione |
| InChIKey | LIVYMRJSNFHYEN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC(=O)N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)