Products 1664332-49-3
CAS 1664332-49-3 is the registry number for N-(2-chloroacetyl)-D-phenylalanine cyanomethyl ester, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyanomethyl (2R)-2-[(2-chloroacetyl)amino]-3-phenylpropanoate (CAS 1664332-49-3) is a chemical compound with the molecular formula C13H13ClN2O3 and a molecular weight of 280.70 g/mol. IUPAC name: cyanomethyl (2R)-2-[(2-chloroacetyl)amino]-3-phenylpropanoate. InChIKey: JBUJWSHUCCXFTC-LLVKDONJSA-N.
| Molecular formula | C13H13ClN2O3 |
|---|---|
| Molecular weight | 280.70 g/mol |
| IUPAC name | cyanomethyl (2R)-2-[(2-chloroacetyl)amino]-3-phenylpropanoate |
| InChIKey | JBUJWSHUCCXFTC-LLVKDONJSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)OCC#N)NC(=O)CCl |
Computed by PubChem (NCBI)