Products 2747915-64-4
CAS 2747915-64-4 appears in our catalog under these names: Ornidazole–d5, Ornidazole-d5. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg.
1-chloro-1,1,2,3,3-pentadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol (CAS 2747915-64-4) is a chemical compound with the molecular formula C7H10ClN3O3 and a molecular weight of 224.65 g/mol. IUPAC name: 1-chloro-1,1,2,3,3-pentadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol. InChIKey: IPWKIXLWTCNBKN-VLZDWVQFSA-N.
| Molecular formula | C7H10ClN3O3 |
|---|---|
| Molecular weight | 224.65 g/mol |
| IUPAC name | 1-chloro-1,1,2,3,3-pentadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol |
| InChIKey | IPWKIXLWTCNBKN-VLZDWVQFSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])Cl)O)N1C(=NC=C1[N+](=O)[O-])C |
Computed by PubChem (NCBI)