CAS 166764-19-8 is the registry number for (2R)-(-)-1,1-BIS(4-METHOXYPHENYL)-3-METHYL-1,2-BUTANEDIAMINE, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g.
(2R)-1,1-bis(4-methoxyphenyl)-3-methylbutane-1,2-diamine (CAS 166764-19-8) is a chemical compound with the molecular formula C19H26N2O2 and a molecular weight of 314.4 g/mol. IUPAC name: (2R)-1,1-bis(4-methoxyphenyl)-3-methylbutane-1,2-diamine. InChIKey: WDYGPMAMBXJESZ-GOSISDBHSA-N.
| Molecular formula | C19H26N2O2 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | (2R)-1,1-bis(4-methoxyphenyl)-3-methylbutane-1,2-diamine |
| InChIKey | WDYGPMAMBXJESZ-GOSISDBHSA-N |
| SMILES | CC(C)[C@H](C(C1=CC=C(C=C1)OC)(C2=CC=C(C=C2)OC)N)N |
Computed by PubChem (NCBI)