Products 1667709-77-4
CAS 1667709-77-4 appears in our catalog under these names: methyl 2-({[(2-oxothiolan-3-yl)carbamoyl]methyl}sulfanyl)acetate, 95%, Erdosteine Methyl Ester, Erdosteine Methyl Ester, >95% (HPLC). Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol. Available pack sizes: 5g, 1g, on request, 250mg, 500mg, 50mg, 25mg, 100mg.
Methyl 2-[2-oxo-2-[(2-oxothiolan-3-yl)amino]ethyl]sulfanylacetate (CAS 1667709-77-4) is a chemical compound with the molecular formula C9H13NO4S2 and a molecular weight of 263.3 g/mol. IUPAC name: methyl 2-[2-oxo-2-[(2-oxothiolan-3-yl)amino]ethyl]sulfanylacetate. InChIKey: VLQHIMHOYRPRTM-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4S2 |
|---|---|
| Molecular weight | 263.3 g/mol |
| IUPAC name | methyl 2-[2-oxo-2-[(2-oxothiolan-3-yl)amino]ethyl]sulfanylacetate |
| InChIKey | VLQHIMHOYRPRTM-UHFFFAOYSA-N |
| SMILES | COC(=O)CSCC(=O)NC1CCSC1=O |
Computed by PubChem (NCBI)