CAS 923220-10-4 appears in our catalog under these names: 4-(N-Methylthiophene-2-sulfonamido)butanoic acid, 95%, 4-[Methyl(thien-2-ylsulfonyl)amino]butanoic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
4-[methyl(thiophen-2-ylsulfonyl)amino]butanoic acid (CAS 923220-10-4) is a chemical compound with the molecular formula C9H13NO4S2 and a molecular weight of 263.3 g/mol. IUPAC name: 4-[methyl(thiophen-2-ylsulfonyl)amino]butanoic acid. InChIKey: ILEQUZALEBCGBU-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4S2 |
|---|---|
| Molecular weight | 263.3 g/mol |
| IUPAC name | 4-[methyl(thiophen-2-ylsulfonyl)amino]butanoic acid |
| InChIKey | ILEQUZALEBCGBU-UHFFFAOYSA-N |
| SMILES | CN(CCCC(=O)O)S(=O)(=O)C1=CC=CS1 |
Computed by PubChem (NCBI)