CAS 82068-14-2 appears in our catalog under these names: 3–Methyl–2–(thiophene–2–sulfonamido)butanoic acid, 3-Methyl-2-(thiophene-2-sulfonylamino)-butyric acid. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg.
3-methyl-2-(thiophen-2-ylsulfonylamino)butanoic acid (CAS 82068-14-2) is a chemical compound with the molecular formula C9H13NO4S2 and a molecular weight of 263.3 g/mol. IUPAC name: 3-methyl-2-(thiophen-2-ylsulfonylamino)butanoic acid. InChIKey: NFORIPALKNQHIR-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4S2 |
|---|---|
| Molecular weight | 263.3 g/mol |
| IUPAC name | 3-methyl-2-(thiophen-2-ylsulfonylamino)butanoic acid |
| InChIKey | NFORIPALKNQHIR-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NS(=O)(=O)C1=CC=CS1 |
Computed by PubChem (NCBI)