Products 950256-64-1

CAS 950256-64-1 is the registry number for 4-(N,N-Diethylsulfamoyl)thiophene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(diethylsulfamoyl)thiophene-2-carboxylic acid (CAS 950256-64-1) is a chemical compound with the molecular formula C9H13NO4S2 and a molecular weight of 263.3 g/mol. IUPAC name: 4-(diethylsulfamoyl)thiophene-2-carboxylic acid. InChIKey: JINWNNOCTXFVFR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13NO4S2
Molecular weight263.3 g/mol
IUPAC name4-(diethylsulfamoyl)thiophene-2-carboxylic acid
InChIKeyJINWNNOCTXFVFR-UHFFFAOYSA-N
SMILESCCN(CC)S(=O)(=O)C1=CSC(=C1)C(=O)O

Computed by PubChem (NCBI)